C19H17ClN4OS — CID 168582413
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine (PubChem CID 168582413) has the molecular formula C19H17ClN4OS and a molecular weight of 384.89 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 168582413 |
| Molecular Formula | C19H17ClN4OS |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine |
| SMILES | CN(C)c1ccc(-c2nc3cc(NCc4cnc(Cl)s4)ccc3o2)cc1 |
| InChI | InChI=1S/C19H17ClN4OS/c1-24(2)14-6-3-12(4-7-14)18-23-16-9-13(5-8-17(16)25-18)21-10-15-11-22-19(20)26-15/h3-9,11,21H,10H2,1-2H3 |
| InChIKey | CGEXHCRRTBBARL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|