C14H18ClN3S — CID 168581662
1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 168581662) has the molecular formula C14H18ClN3S and a molecular weight of 295.84 g/mol. Its IUPAC name is 1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 168581662 |
| Molecular Formula | C14H18ClN3S |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C14H18ClN3S/c1-3-18(4-2)12-7-5-11(6-8-12)16-9-13-10-17-14(15)19-13/h5-8,10,16H,3-4,9H2,1-2H3 |
| InChIKey | RXXXBBRVMPKKFU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|