C11H8ClN3S — CID 168579564
4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzonitrile (PubChem CID 168579564) has the molecular formula C11H8ClN3S and a molecular weight of 249.73 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzonitrile.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 168579564 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C11H8ClN3S/c12-11-15-7-10(16-11)6-14-9-3-1-8(5-13)2-4-9/h1-4,7,14H,6H2 |
| InChIKey | HYLBOSRBKTUGFS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |