C18H17ClN2O2S — CID 168583829
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-phenoxyethoxy)aniline (PubChem CID 168583829) has the molecular formula C18H17ClN2O2S and a molecular weight of 360.87 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-phenoxyethoxy)aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-phenoxyethoxy)aniline |
|---|---|
| PubChem CID | 168583829 |
| Molecular Formula | C18H17ClN2O2S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-phenoxyethoxy)aniline |
| SMILES | Clc1ncc(CNc2ccc(OCCOc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C18H17ClN2O2S/c19-18-21-13-17(24-18)12-20-14-6-8-16(9-7-14)23-11-10-22-15-4-2-1-3-5-15/h1-9,13,20H,10-12H2 |
| InChIKey | VHOWYYDUOHEHMS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|