C16H17ClN4OS — CID 168582679
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(1,5-dimethylpyrazol-4-yl)methoxy]aniline (PubChem CID 168582679) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(1,5-dimethylpyrazol-4-yl)methoxy]aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(1,5-dimethylpyrazol-4-yl)methoxy]aniline |
|---|---|
| PubChem CID | 168582679 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-[(1,5-dimethylpyrazol-4-yl)methoxy]aniline |
| SMILES | Cc1c(COc2ccc(NCc3cnc(Cl)s3)cc2)cnn1C |
| InChI | InChI=1S/C16H17ClN4OS/c1-11-12(7-20-21(11)2)10-22-14-5-3-13(4-6-14)18-8-15-9-19-16(17)23-15/h3-7,9,18H,8,10H2,1-2H3 |
| InChIKey | BVPUFNOVWRINDZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|