C13H17N3 — CID 19619046
N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-methylaniline (PubChem CID 19619046) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-methylaniline.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-methylaniline |
|---|---|
| PubChem CID | 19619046 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-4-methylaniline |
| SMILES | Cc1ccc(NCc2cnn(C)c2C)cc1 |
| InChI | InChI=1S/C13H17N3/c1-10-4-6-13(7-5-10)14-8-12-9-15-16(3)11(12)2/h4-7,9,14H,8H2,1-3H3 |
| InChIKey | XKZWNXQYOBOJDO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |