C15H19N3O3 — CID 79570390
methyl 2-[4-[(1,5-dimethylpyrazol-4-yl)methylamino]phenoxy]acetate (PubChem CID 79570390) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 2-[4-[(1,5-dimethylpyrazol-4-yl)methylamino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(1,5-dimethylpyrazol-4-yl)methylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 79570390 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl 2-[4-[(1,5-dimethylpyrazol-4-yl)methylamino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NCc2cnn(C)c2C)cc1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-12(9-17-18(11)2)8-16-13-4-6-14(7-5-13)21-10-15(19)20-3/h4-7,9,16H,8,10H2,1-3H3 |
| InChIKey | KKSWALADMPMKSS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|