C12H14BrN3 — CID 79578438
4-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]aniline (PubChem CID 79578438) has the molecular formula C12H14BrN3 and a molecular weight of 280.17 g/mol. Its IUPAC name is 4-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]aniline.
| Compound Name | 4-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 79578438 |
| Molecular Formula | C12H14BrN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]aniline |
| SMILES | Cc1c(CNc2ccc(Br)cc2)cnn1C |
| InChI | InChI=1S/C12H14BrN3/c1-9-10(8-15-16(9)2)7-14-12-5-3-11(13)4-6-12/h3-6,8,14H,7H2,1-2H3 |
| InChIKey | KWBXNJUJOYWQRY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |