C17H22ClN3OS — CID 168584019
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-piperidin-1-ylethoxy)aniline (PubChem CID 168584019) has the molecular formula C17H22ClN3OS and a molecular weight of 351.90 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-piperidin-1-ylethoxy)aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-piperidin-1-ylethoxy)aniline |
|---|---|
| PubChem CID | 168584019 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(2-piperidin-1-ylethoxy)aniline |
| SMILES | Clc1ncc(CNc2ccc(OCCN3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C17H22ClN3OS/c18-17-20-13-16(23-17)12-19-14-4-6-15(7-5-14)22-11-10-21-8-2-1-3-9-21/h4-7,13,19H,1-3,8-12H2 |
| InChIKey | DJZCOUMONPQDTP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|