C17H23ClN4S — CID 168582880
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(4-propylpiperazin-1-yl)aniline (PubChem CID 168582880) has the molecular formula C17H23ClN4S and a molecular weight of 350.92 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(4-propylpiperazin-1-yl)aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(4-propylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 168582880 |
| Molecular Formula | C17H23ClN4S |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-(4-propylpiperazin-1-yl)aniline |
| SMILES | CCCN1CCN(c2ccc(NCc3cnc(Cl)s3)cc2)CC1 |
| InChI | InChI=1S/C17H23ClN4S/c1-2-7-21-8-10-22(11-9-21)15-5-3-14(4-6-15)19-12-16-13-20-17(18)23-16/h3-6,13,19H,2,7-12H2,1H3 |
| InChIKey | FIYLMBPBSRWIAA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|