C18H22Cl2N4OS — CID 168583526
1-[4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]butan-1-one (PubChem CID 168583526) has the molecular formula C18H22Cl2N4OS and a molecular weight of 413.37 g/mol. Its IUPAC name is 1-[4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 168583526 |
| Molecular Formula | C18H22Cl2N4OS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[4-[2-chloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(c2ccc(NCc3cnc(Cl)s3)cc2Cl)CC1 |
| InChI | InChI=1S/C18H22Cl2N4OS/c1-2-3-17(25)24-8-6-23(7-9-24)16-5-4-13(10-15(16)19)21-11-14-12-22-18(20)26-14/h4-5,10,12,21H,2-3,6-9,11H2,1H3 |
| InChIKey | KVQNEDMVKQFYNF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|