C14H14ClN3OS — CID 168583424
5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-1-ethyl-3H-indol-2-one (PubChem CID 168583424) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-1-ethyl-3H-indol-2-one.
| Compound Name | 5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-1-ethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 168583424 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-1-ethyl-3H-indol-2-one |
| SMILES | CCN1C(=O)Cc2cc(NCc3cnc(Cl)s3)ccc21 |
| InChI | InChI=1S/C14H14ClN3OS/c1-2-18-12-4-3-10(5-9(12)6-13(18)19)16-7-11-8-17-14(15)20-11/h3-5,8,16H,2,6-7H2,1H3 |
| InChIKey | PYKBTQXHPWFWEV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |