C19H13Cl2N3O2S — CID 168581302
5-chloro-2-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylphenyl]isoindole-1,3-dione (PubChem CID 168581302) has the molecular formula C19H13Cl2N3O2S and a molecular weight of 418.31 g/mol. Its IUPAC name is 5-chloro-2-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylphenyl]isoindole-1,3-dione.
| Compound Name | 5-chloro-2-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168581302 |
| Molecular Formula | C19H13Cl2N3O2S |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 5-chloro-2-[4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-methylphenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(NCc2cnc(Cl)s2)ccc1N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C19H13Cl2N3O2S/c1-10-6-12(22-8-13-9-23-19(21)27-13)3-5-16(10)24-17(25)14-4-2-11(20)7-15(14)18(24)26/h2-7,9,22H,8H2,1H3 |
| InChIKey | VVGNMJMQWAWNKN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|