C16H16ClN3O2S — CID 168581821
2-tert-butyl-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]isoindole-1,3-dione (PubChem CID 168581821) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-tert-butyl-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]isoindole-1,3-dione.
| Compound Name | 2-tert-butyl-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168581821 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-tert-butyl-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]isoindole-1,3-dione |
| SMILES | CC(C)(C)N1C(=O)c2ccc(NCc3cnc(Cl)s3)cc2C1=O |
| InChI | InChI=1S/C16H16ClN3O2S/c1-16(2,3)20-13(21)11-5-4-9(6-12(11)14(20)22)18-7-10-8-19-15(17)23-10/h4-6,8,18H,7H2,1-3H3 |
| InChIKey | UVLNUVNFLQLSFM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|