C13H9ClN2O2S — CID 168583307
6-[(2-chloro-1,3-thiazol-5-yl)methylamino]chromen-4-one (PubChem CID 168583307) has the molecular formula C13H9ClN2O2S and a molecular weight of 292.75 g/mol. Its IUPAC name is 6-[(2-chloro-1,3-thiazol-5-yl)methylamino]chromen-4-one.
| Compound Name | 6-[(2-chloro-1,3-thiazol-5-yl)methylamino]chromen-4-one |
|---|---|
| PubChem CID | 168583307 |
| Molecular Formula | C13H9ClN2O2S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 6-[(2-chloro-1,3-thiazol-5-yl)methylamino]chromen-4-one |
| SMILES | O=c1ccoc2ccc(NCc3cnc(Cl)s3)cc12 |
| InChI | InChI=1S/C13H9ClN2O2S/c14-13-16-7-9(19-13)6-15-8-1-2-12-10(5-8)11(17)3-4-18-12/h1-5,7,15H,6H2 |
| InChIKey | CTHGIZZWSUEIHQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |