C10H8ClN3O3S — CID 168579558
4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrophenol (PubChem CID 168579558) has the molecular formula C10H8ClN3O3S and a molecular weight of 285.71 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrophenol.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrophenol |
|---|---|
| PubChem CID | 168579558 |
| Molecular Formula | C10H8ClN3O3S |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(NCc2cnc(Cl)s2)ccc1O |
| InChI | InChI=1S/C10H8ClN3O3S/c11-10-13-5-7(18-10)4-12-6-1-2-9(15)8(3-6)14(16)17/h1-3,5,12,15H,4H2 |
| InChIKey | VUMHYJNNDDUFTJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|