C10H6BrClN4O4S — CID 168580748
2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,6-dinitroaniline (PubChem CID 168580748) has the molecular formula C10H6BrClN4O4S and a molecular weight of 393.61 g/mol. Its IUPAC name is 2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,6-dinitroaniline.
| Compound Name | 2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,6-dinitroaniline |
|---|---|
| PubChem CID | 168580748 |
| Molecular Formula | C10H6BrClN4O4S |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,6-dinitroaniline |
| SMILES | O=[N+]([O-])c1cc(Br)c(NCc2cnc(Cl)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H6BrClN4O4S/c11-7-1-5(15(17)18)2-8(16(19)20)9(7)13-3-6-4-14-10(12)21-6/h1-2,4,13H,3H2 |
| InChIKey | ZSMLAOQQAMFIGA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|