C18H9Br2ClN2O2S — CID 168580735
2,4-dibromo-1-[(2-chloro-1,3-thiazol-5-yl)methylamino]anthracene-9,10-dione (PubChem CID 168580735) has the molecular formula C18H9Br2ClN2O2S and a molecular weight of 512.61 g/mol. Its IUPAC name is 2,4-dibromo-1-[(2-chloro-1,3-thiazol-5-yl)methylamino]anthracene-9,10-dione.
| Compound Name | 2,4-dibromo-1-[(2-chloro-1,3-thiazol-5-yl)methylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 168580735 |
| Molecular Formula | C18H9Br2ClN2O2S |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 509.84 |
| IUPAC Name | 2,4-dibromo-1-[(2-chloro-1,3-thiazol-5-yl)methylamino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCc3cnc(Cl)s3)c(Br)cc(Br)c21 |
| InChI | InChI=1S/C18H9Br2ClN2O2S/c19-11-5-12(20)15(22-6-8-7-23-18(21)26-8)14-13(11)16(24)9-3-1-2-4-10(9)17(14)25/h1-5,7,22H,6H2 |
| InChIKey | IQSQSBDIOVAHHH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|