C11H6Br2ClFN2O2S — CID 168581375
3,5-dibromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-6-fluorobenzoic acid (PubChem CID 168581375) has the molecular formula C11H6Br2ClFN2O2S and a molecular weight of 444.51 g/mol. Its IUPAC name is 3,5-dibromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-6-fluorobenzoic acid.
| Compound Name | 3,5-dibromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 168581375 |
| Molecular Formula | C11H6Br2ClFN2O2S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 441.82 |
| IUPAC Name | 3,5-dibromo-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(Br)cc(Br)c1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C11H6Br2ClFN2O2S/c12-5-1-6(13)9(7(8(5)15)10(18)19)16-2-4-3-17-11(14)20-4/h1,3,16H,2H2,(H,18,19) |
| InChIKey | FKPDRSRZPOGIMV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|