C11H8BrClN2O2S — CID 168579944
2-bromo-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid (PubChem CID 168579944) has the molecular formula C11H8BrClN2O2S and a molecular weight of 347.62 g/mol. Its IUPAC name is 2-bromo-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid.
| Compound Name | 2-bromo-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 168579944 |
| Molecular Formula | C11H8BrClN2O2S |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 2-bromo-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NCc2cnc(Cl)s2)c1Br |
| InChI | InChI=1S/C11H8BrClN2O2S/c12-9-7(10(16)17)2-1-3-8(9)14-4-6-5-15-11(13)18-6/h1-3,5,14H,4H2,(H,16,17) |
| InChIKey | JBKUUDIKKUBGOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |