C12H10ClIN2O3S — CID 168583321
4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-iodo-2-methoxybenzoic acid (PubChem CID 168583321) has the molecular formula C12H10ClIN2O3S and a molecular weight of 424.65 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-iodo-2-methoxybenzoic acid.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-iodo-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 168583321 |
| Molecular Formula | C12H10ClIN2O3S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-iodo-2-methoxybenzoic acid |
| SMILES | COc1cc(NCc2cnc(Cl)s2)c(I)cc1C(=O)O |
| InChI | InChI=1S/C12H10ClIN2O3S/c1-19-10-3-9(8(14)2-7(10)11(17)18)15-4-6-5-16-12(13)20-6/h2-3,5,15H,4H2,1H3,(H,17,18) |
| InChIKey | BKUAMJFOLYRVAE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|