C13H14ClN3O2S2 — CID 168580701
2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4,5-dimethoxybenzenecarbothioamide (PubChem CID 168580701) has the molecular formula C13H14ClN3O2S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4,5-dimethoxybenzenecarbothioamide.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4,5-dimethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 168580701 |
| Molecular Formula | C13H14ClN3O2S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4,5-dimethoxybenzenecarbothioamide |
| SMILES | COc1cc(NCc2cnc(Cl)s2)c(C(N)=S)cc1OC |
| InChI | InChI=1S/C13H14ClN3O2S2/c1-18-10-3-8(12(15)20)9(4-11(10)19-2)16-5-7-6-17-13(14)21-7/h3-4,6,16H,5H2,1-2H3,(H2,15,20) |
| InChIKey | HYNJUTTVQWXEBR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|