C12H12ClN3S2 — CID 62493698
5-chloro-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide (PubChem CID 62493698) has the molecular formula C12H12ClN3S2 and a molecular weight of 297.84 g/mol. Its IUPAC name is 5-chloro-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide.
| Compound Name | 5-chloro-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62493698 |
| Molecular Formula | C12H12ClN3S2 |
| Molecular Weight | 297.84 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 5-chloro-2-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1ncc(CNc2ccc(Cl)cc2C(N)=S)s1 |
| InChI | InChI=1S/C12H12ClN3S2/c1-7-15-5-9(18-7)6-16-11-3-2-8(13)4-10(11)12(14)17/h2-5,16H,6H2,1H3,(H2,14,17) |
| InChIKey | SPHQOWFVZMDWSI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.84 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|