C14H15ClN2S2 — CID 65243824
4-chloro-2-[(4,5-dimethylthiophen-2-yl)methylamino]benzenecarbothioamide (PubChem CID 65243824) has the molecular formula C14H15ClN2S2 and a molecular weight of 310.88 g/mol. Its IUPAC name is 4-chloro-2-[(4,5-dimethylthiophen-2-yl)methylamino]benzenecarbothioamide.
| Compound Name | 4-chloro-2-[(4,5-dimethylthiophen-2-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 65243824 |
| Molecular Formula | C14H15ClN2S2 |
| Molecular Weight | 310.88 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-chloro-2-[(4,5-dimethylthiophen-2-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1cc(CNc2cc(Cl)ccc2C(N)=S)sc1C |
| InChI | InChI=1S/C14H15ClN2S2/c1-8-5-11(19-9(8)2)7-17-13-6-10(15)3-4-12(13)14(16)18/h3-6,17H,7H2,1-2H3,(H2,16,18) |
| InChIKey | SNVRTIJSWRRKDQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|