C13H16N2S — CID 65246171
2-N-[(4,5-dimethylthiophen-2-yl)methyl]benzene-1,2-diamine (PubChem CID 65246171) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-N-[(4,5-dimethylthiophen-2-yl)methyl]benzene-1,2-diamine.
| Compound Name | 2-N-[(4,5-dimethylthiophen-2-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 65246171 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-N-[(4,5-dimethylthiophen-2-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1cc(CNc2ccccc2N)sc1C |
| InChI | InChI=1S/C13H16N2S/c1-9-7-11(16-10(9)2)8-15-13-6-4-3-5-12(13)14/h3-7,15H,8,14H2,1-2H3 |
| InChIKey | MXRREPRYLBUFFN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|