C16H20N2O2S — CID 65245847
ethyl 3-amino-4-[(4,5-dimethylthiophen-2-yl)methylamino]benzoate (PubChem CID 65245847) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 3-amino-4-[(4,5-dimethylthiophen-2-yl)methylamino]benzoate.
| Compound Name | ethyl 3-amino-4-[(4,5-dimethylthiophen-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 65245847 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 3-amino-4-[(4,5-dimethylthiophen-2-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCc2cc(C)c(C)s2)c(N)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-4-20-16(19)12-5-6-15(14(17)8-12)18-9-13-7-10(2)11(3)21-13/h5-8,18H,4,9,17H2,1-3H3 |
| InChIKey | BFGQNTJIBWGSPE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|