C14H19F3N2O2 — CID 115521859
ethyl 3-amino-4-(5,5,5-trifluoropentylamino)benzoate (PubChem CID 115521859) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is ethyl 3-amino-4-(5,5,5-trifluoropentylamino)benzoate.
| Compound Name | ethyl 3-amino-4-(5,5,5-trifluoropentylamino)benzoate |
|---|---|
| PubChem CID | 115521859 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethyl 3-amino-4-(5,5,5-trifluoropentylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NCCCCC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-2-21-13(20)10-5-6-12(11(18)9-10)19-8-4-3-7-14(15,16)17/h5-6,9,19H,2-4,7-8,18H2,1H3 |
| InChIKey | WCPHGFTVDDBEHD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|