C14H14F2N2S2 — CID 81286853
4-[(4,5-dimethylthiophen-2-yl)methylamino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286853) has the molecular formula C14H14F2N2S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-[(4,5-dimethylthiophen-2-yl)methylamino]-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-[(4,5-dimethylthiophen-2-yl)methylamino]-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286853 |
| Molecular Formula | C14H14F2N2S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-[(4,5-dimethylthiophen-2-yl)methylamino]-3,5-difluorobenzenecarbothioamide |
| SMILES | Cc1cc(CNc2c(F)cc(C(N)=S)cc2F)sc1C |
| InChI | InChI=1S/C14H14F2N2S2/c1-7-3-10(20-8(7)2)6-18-13-11(15)4-9(14(17)19)5-12(13)16/h3-5,18H,6H2,1-2H3,(H2,17,19) |
| InChIKey | NFEVJZLAXLSOBC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|