C12H8BrF4NS — CID 107643706
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107643706) has the molecular formula C12H8BrF4NS and a molecular weight of 354.17 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643706 |
| Molecular Formula | C12H8BrF4NS |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | Cc1sc(CNc2c(F)c(F)cc(F)c2F)cc1Br |
| InChI | InChI=1S/C12H8BrF4NS/c1-5-7(13)2-6(19-5)4-18-12-10(16)8(14)3-9(15)11(12)17/h2-3,18H,4H2,1H3 |
| InChIKey | XDLUZSLPVIRVMR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|