C13H10BrClF3NS — CID 102837817
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)aniline (PubChem CID 102837817) has the molecular formula C13H10BrClF3NS and a molecular weight of 384.65 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)aniline.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 102837817 |
| Molecular Formula | C13H10BrClF3NS |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)aniline |
| SMILES | Cc1sc(CNc2cc(Cl)cc(C(F)(F)F)c2)cc1Br |
| InChI | InChI=1S/C13H10BrClF3NS/c1-7-12(14)5-11(20-7)6-19-10-3-8(13(16,17)18)2-9(15)4-10/h2-5,19H,6H2,1H3 |
| InChIKey | PQBVUQNGTSCYOI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |