C12H7BrF5NS — CID 102836995
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,4,5,6-pentafluoroaniline (PubChem CID 102836995) has the molecular formula C12H7BrF5NS and a molecular weight of 372.16 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 102836995 |
| Molecular Formula | C12H7BrF5NS |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,3,4,5,6-pentafluoroaniline |
| SMILES | Cc1sc(CNc2c(F)c(F)c(F)c(F)c2F)cc1Br |
| InChI | InChI=1S/C12H7BrF5NS/c1-4-6(13)2-5(20-4)3-19-12-10(17)8(15)7(14)9(16)11(12)18/h2,19H,3H2,1H3 |
| InChIKey | MMNRZYULJXALCC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|