C12H9BrF2N2O2S — CID 102833199
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,4-difluoro-5-nitroaniline (PubChem CID 102833199) has the molecular formula C12H9BrF2N2O2S and a molecular weight of 363.18 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,4-difluoro-5-nitroaniline.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,4-difluoro-5-nitroaniline |
|---|---|
| PubChem CID | 102833199 |
| Molecular Formula | C12H9BrF2N2O2S |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-2,4-difluoro-5-nitroaniline |
| SMILES | Cc1sc(CNc2cc([N+](=O)[O-])c(F)cc2F)cc1Br |
| InChI | InChI=1S/C12H9BrF2N2O2S/c1-6-8(13)2-7(20-6)5-16-11-4-12(17(18)19)10(15)3-9(11)14/h2-4,16H,5H2,1H3 |
| InChIKey | AUNYRAPWAGYLSF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|