C12H17F2N3O2 — CID 107445129
N'-tert-butyl-N-(2,4-difluoro-5-nitrophenyl)ethane-1,2-diamine (PubChem CID 107445129) has the molecular formula C12H17F2N3O2 and a molecular weight of 273.28 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,4-difluoro-5-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-(2,4-difluoro-5-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107445129 |
| Molecular Formula | C12H17F2N3O2 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N'-tert-butyl-N-(2,4-difluoro-5-nitrophenyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H17F2N3O2/c1-12(2,3)16-5-4-15-10-7-11(17(18)19)9(14)6-8(10)13/h6-7,15-16H,4-5H2,1-3H3 |
| InChIKey | RSJRBZBRCSEULT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|