C13H10F2N2O4 — CID 43725126
4-[(2,4-difluoro-5-nitroanilino)methyl]benzene-1,2-diol (PubChem CID 43725126) has the molecular formula C13H10F2N2O4 and a molecular weight of 296.23 g/mol. Its IUPAC name is 4-[(2,4-difluoro-5-nitroanilino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(2,4-difluoro-5-nitroanilino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43725126 |
| Molecular Formula | C13H10F2N2O4 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[(2,4-difluoro-5-nitroanilino)methyl]benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(NCc2ccc(O)c(O)c2)c(F)cc1F |
| InChI | InChI=1S/C13H10F2N2O4/c14-8-4-9(15)11(17(20)21)5-10(8)16-6-7-1-2-12(18)13(19)3-7/h1-5,16,18-19H,6H2 |
| InChIKey | BZCOGNONZNTQNI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|