C9H6F2N4O2S — CID 43725199
2,4-difluoro-5-nitro-N-(thiadiazol-4-ylmethyl)aniline (PubChem CID 43725199) has the molecular formula C9H6F2N4O2S and a molecular weight of 272.24 g/mol. Its IUPAC name is 2,4-difluoro-5-nitro-N-(thiadiazol-4-ylmethyl)aniline.
| Compound Name | 2,4-difluoro-5-nitro-N-(thiadiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 43725199 |
| Molecular Formula | C9H6F2N4O2S |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2,4-difluoro-5-nitro-N-(thiadiazol-4-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(NCc2csnn2)c(F)cc1F |
| InChI | InChI=1S/C9H6F2N4O2S/c10-6-1-7(11)9(15(16)17)2-8(6)12-3-5-4-18-14-13-5/h1-2,4,12H,3H2 |
| InChIKey | ILNSCHIEOFBFES-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|