C12H12F2N4O2 — CID 114555274
N-[(2-ethylpyrazol-3-yl)methyl]-2,4-difluoro-5-nitroaniline (PubChem CID 114555274) has the molecular formula C12H12F2N4O2 and a molecular weight of 282.25 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-2,4-difluoro-5-nitroaniline.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-2,4-difluoro-5-nitroaniline |
|---|---|
| PubChem CID | 114555274 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-2,4-difluoro-5-nitroaniline |
| SMILES | CCn1nccc1CNc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H12F2N4O2/c1-2-17-8(3-4-16-17)7-15-11-6-12(18(19)20)10(14)5-9(11)13/h3-6,15H,2,7H2,1H3 |
| InChIKey | ZJCJDLJEYIUOEA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|