C12H16F2N2O3 — CID 81413065
2-[(2,4-difluoro-5-nitroanilino)methyl]-2-methylbutan-1-ol (PubChem CID 81413065) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[(2,4-difluoro-5-nitroanilino)methyl]-2-methylbutan-1-ol.
| Compound Name | 2-[(2,4-difluoro-5-nitroanilino)methyl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 81413065 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[(2,4-difluoro-5-nitroanilino)methyl]-2-methylbutan-1-ol |
| SMILES | CCC(C)(CO)CNc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H16F2N2O3/c1-3-12(2,7-17)6-15-10-5-11(16(18)19)9(14)4-8(10)13/h4-5,15,17H,3,6-7H2,1-2H3 |
| InChIKey | UAHKIEAVKYQUBP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|