C12H14F2N2O5 — CID 107866615
2,4-difluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-nitrobenzamide (PubChem CID 107866615) has the molecular formula C12H14F2N2O5 and a molecular weight of 304.25 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-nitrobenzamide.
| Compound Name | 2,4-difluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 107866615 |
| Molecular Formula | C12H14F2N2O5 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2,4-difluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-nitrobenzamide |
| SMILES | CCC(CO)(CO)NC(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O5/c1-2-12(5-17,6-18)15-11(19)7-3-10(16(20)21)9(14)4-8(7)13/h3-4,17-18H,2,5-6H2,1H3,(H,15,19) |
| InChIKey | DMVZHSMNVDDOGL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|