C14H20N2O4 — CID 65463249
N-[3-(hydroxymethyl)pentan-3-yl]-5-methyl-2-nitrobenzamide (PubChem CID 65463249) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)pentan-3-yl]-5-methyl-2-nitrobenzamide.
| Compound Name | N-[3-(hydroxymethyl)pentan-3-yl]-5-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 65463249 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[3-(hydroxymethyl)pentan-3-yl]-5-methyl-2-nitrobenzamide |
| SMILES | CCC(CC)(CO)NC(=O)c1cc(C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O4/c1-4-14(5-2,9-17)15-13(18)11-8-10(3)6-7-12(11)16(19)20/h6-8,17H,4-5,9H2,1-3H3,(H,15,18) |
| InChIKey | RKLGTDIZUDJESL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|