C13H16F2N2O4 — CID 106352916
2,4-difluoro-N-(1-hydroxy-4-methylpentan-3-yl)-5-nitrobenzamide (PubChem CID 106352916) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,4-difluoro-N-(1-hydroxy-4-methylpentan-3-yl)-5-nitrobenzamide.
| Compound Name | 2,4-difluoro-N-(1-hydroxy-4-methylpentan-3-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 106352916 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2,4-difluoro-N-(1-hydroxy-4-methylpentan-3-yl)-5-nitrobenzamide |
| SMILES | CC(C)C(CCO)NC(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C13H16F2N2O4/c1-7(2)11(3-4-18)16-13(19)8-5-12(17(20)21)10(15)6-9(8)14/h5-7,11,18H,3-4H2,1-2H3,(H,16,19) |
| InChIKey | UAFHUWFTOYZZMD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|