C11H10F2N2O6 — CID 107823054
(2R)-2-[(2,5-difluoro-4-nitrobenzoyl)amino]-4-hydroxybutanoic acid (PubChem CID 107823054) has the molecular formula C11H10F2N2O6 and a molecular weight of 304.21 g/mol. Its IUPAC name is (2R)-2-[(2,5-difluoro-4-nitrobenzoyl)amino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(2,5-difluoro-4-nitrobenzoyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107823054 |
| Molecular Formula | C11H10F2N2O6 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (2R)-2-[(2,5-difluoro-4-nitrobenzoyl)amino]-4-hydroxybutanoic acid |
| SMILES | O=C(N[C@H](CCO)C(=O)O)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H10F2N2O6/c12-6-4-9(15(20)21)7(13)3-5(6)10(17)14-8(1-2-16)11(18)19/h3-4,8,16H,1-2H2,(H,14,17)(H,18,19)/t8-/m1/s1 |
| InChIKey | PXAKOXKWRRFJMM-MRVPVSSYSA-N |
| XLogP | 0.44 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|