C10H10F2N2O5 — CID 65315195
N-(1,3-dihydroxypropan-2-yl)-2,4-difluoro-5-nitrobenzamide (PubChem CID 65315195) has the molecular formula C10H10F2N2O5 and a molecular weight of 276.19 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2,4-difluoro-5-nitrobenzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2,4-difluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 65315195 |
| Molecular Formula | C10H10F2N2O5 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2,4-difluoro-5-nitrobenzamide |
| SMILES | O=C(NC(CO)CO)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C10H10F2N2O5/c11-7-2-8(12)9(14(18)19)1-6(7)10(17)13-5(3-15)4-16/h1-2,5,15-16H,3-4H2,(H,13,17) |
| InChIKey | NZSULNNQPVNERI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|