C10H11FN2O5 — CID 65315617
N-(1,3-dihydroxypropan-2-yl)-5-fluoro-2-nitrobenzamide (PubChem CID 65315617) has the molecular formula C10H11FN2O5 and a molecular weight of 258.20 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-5-fluoro-2-nitrobenzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-5-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 65315617 |
| Molecular Formula | C10H11FN2O5 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-5-fluoro-2-nitrobenzamide |
| SMILES | O=C(NC(CO)CO)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11FN2O5/c11-6-1-2-9(13(17)18)8(3-6)10(16)12-7(4-14)5-15/h1-3,7,14-15H,4-5H2,(H,12,16) |
| InChIKey | JDRFJVKKFGYKFL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|