C12H15FN2O6 — CID 107865932
2-fluoro-5-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-nitrobenzoic acid (PubChem CID 107865932) has the molecular formula C12H15FN2O6 and a molecular weight of 302.26 g/mol. Its IUPAC name is 2-fluoro-5-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-nitrobenzoic acid.
| Compound Name | 2-fluoro-5-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 107865932 |
| Molecular Formula | C12H15FN2O6 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-fluoro-5-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-nitrobenzoic acid |
| SMILES | CCC(CO)(CO)Nc1cc(C(=O)O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15FN2O6/c1-2-12(5-16,6-17)14-9-3-7(11(18)19)8(13)4-10(9)15(20)21/h3-4,14,16-17H,2,5-6H2,1H3,(H,18,19) |
| InChIKey | PFJYETAKVLZKOI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|