C11H10F4N2O4 — CID 104700081
2-fluoro-4-nitro-5-(4,4,4-trifluorobutylamino)benzoic acid (PubChem CID 104700081) has the molecular formula C11H10F4N2O4 and a molecular weight of 310.20 g/mol. Its IUPAC name is 2-fluoro-4-nitro-5-(4,4,4-trifluorobutylamino)benzoic acid.
| Compound Name | 2-fluoro-4-nitro-5-(4,4,4-trifluorobutylamino)benzoic acid |
|---|---|
| PubChem CID | 104700081 |
| Molecular Formula | C11H10F4N2O4 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-fluoro-4-nitro-5-(4,4,4-trifluorobutylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NCCCC(F)(F)F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H10F4N2O4/c12-7-5-9(17(20)21)8(4-6(7)10(18)19)16-3-1-2-11(13,14)15/h4-5,16H,1-3H2,(H,18,19) |
| InChIKey | ZVANAQRBQXXMLZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|