About 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid
5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid (PubChem CID 115520074) has the molecular formula C11H11ClF3NO2
and a molecular weight of 281.66 g/mol. Its IUPAC name is 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid.
Molecular Properties
| Compound Name | 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid |
| PubChem CID | 115520074 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1NCCCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2/c12-7-2-3-9(8(6-7)10(17)18)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18) |
| InChIKey | QMOCYVHYHUEBFD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
The IUPAC name of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid (CID 115520074) is 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid.
What is the SMILES notation for 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
The canonical SMILES for 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid is O=C(O)c1cc(Cl)ccc1NCCCC(F)(F)F.
What is the InChIKey of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
The InChIKey is QMOCYVHYHUEBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3NO2/c12-7-2-3-9(8(6-7)10(17)18)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18).
What are the key properties of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid has a molecular weight of 281.66 g/mol, XLogP of 3.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid is sourced from PubChem (CID 115520074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).