C11H11ClF3NO2 — CID 115520074
5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid (PubChem CID 115520074) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid.
| Compound Name | 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid |
|---|---|
| PubChem CID | 115520074 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1NCCCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2/c12-7-2-3-9(8(6-7)10(17)18)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18) |
| InChIKey | QMOCYVHYHUEBFD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|