5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid

C11H11ClF3NO2 — CID 115520074

IUPAC5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid
SMILESO=C(O)c1cc(Cl)ccc1NCCCC(F)(F)F
InChIInChI=1S/C11H11ClF3NO2/c12-7-2-3-9(8(6-7)10(17)18)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18)
InChIKeyQMOCYVHYHUEBFD-UHFFFAOYSA-N
MW281.66 g/mol
LogP3.79
Rot. Bonds5

About 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid

5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid (PubChem CID 115520074) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid.

Molecular Properties

Compound Name5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid
PubChem CID115520074
Molecular FormulaC11H11ClF3NO2
Molecular Weight281.66 g/mol
Exact Mass281.04
IUPAC Name5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid
SMILESO=C(O)c1cc(Cl)ccc1NCCCC(F)(F)F
InChIInChI=1S/C11H11ClF3NO2/c12-7-2-3-9(8(6-7)10(17)18)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18)
InChIKeyQMOCYVHYHUEBFD-UHFFFAOYSA-N
XLogP3.79
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.66
LogP ≤ 53.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
The IUPAC name of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid (CID 115520074) is 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid.
What is the SMILES notation for 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
The canonical SMILES for 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid is O=C(O)c1cc(Cl)ccc1NCCCC(F)(F)F.
What is the InChIKey of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
The InChIKey is QMOCYVHYHUEBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3NO2/c12-7-2-3-9(8(6-7)10(17)18)16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5H2,(H,17,18).
What are the key properties of 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid?
5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid has a molecular weight of 281.66 g/mol, XLogP of 3.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(4,4,4-trifluorobutylamino)benzoic acid is sourced from PubChem (CID 115520074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).