C12H11F6NO2 — CID 115522252
5-(4,4,4-trifluorobutylamino)-2-(trifluoromethyl)benzoic acid (PubChem CID 115522252) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 5-(4,4,4-trifluorobutylamino)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-(4,4,4-trifluorobutylamino)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 115522252 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(4,4,4-trifluorobutylamino)-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(NCCCC(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H11F6NO2/c13-11(14,15)4-1-5-19-7-2-3-9(12(16,17)18)8(6-7)10(20)21/h2-3,6,19H,1,4-5H2,(H,20,21) |
| InChIKey | BWENVUBBYUNOSP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|