C13H17F3N2O2 — CID 82950080
5-[1-(dimethylamino)propan-2-ylamino]-2-(trifluoromethyl)benzoic acid (PubChem CID 82950080) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-[1-(dimethylamino)propan-2-ylamino]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-[1-(dimethylamino)propan-2-ylamino]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 82950080 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5-[1-(dimethylamino)propan-2-ylamino]-2-(trifluoromethyl)benzoic acid |
| SMILES | CC(CN(C)C)Nc1ccc(C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-8(7-18(2)3)17-9-4-5-11(13(14,15)16)10(6-9)12(19)20/h4-6,8,17H,7H2,1-3H3,(H,19,20) |
| InChIKey | SCDHSJADMKMTBA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |