C12H12F3NO2 — CID 114619119
5-(2-methylprop-2-enylamino)-2-(trifluoromethyl)benzoic acid (PubChem CID 114619119) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 5-(2-methylprop-2-enylamino)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-(2-methylprop-2-enylamino)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 114619119 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-(2-methylprop-2-enylamino)-2-(trifluoromethyl)benzoic acid |
| SMILES | C=C(C)CNc1ccc(C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12F3NO2/c1-7(2)6-16-8-3-4-10(12(13,14)15)9(5-8)11(17)18/h3-5,16H,1,6H2,2H3,(H,17,18) |
| InChIKey | ZWJVARIJINSEDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|