C11H13F3N2O2 — CID 115521848
2-amino-5-(4,4,4-trifluorobutylamino)benzoic acid (PubChem CID 115521848) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-amino-5-(4,4,4-trifluorobutylamino)benzoic acid.
| Compound Name | 2-amino-5-(4,4,4-trifluorobutylamino)benzoic acid |
|---|---|
| PubChem CID | 115521848 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-amino-5-(4,4,4-trifluorobutylamino)benzoic acid |
| SMILES | Nc1ccc(NCCCC(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C11H13F3N2O2/c12-11(13,14)4-1-5-16-7-2-3-9(15)8(6-7)10(17)18/h2-3,6,16H,1,4-5,15H2,(H,17,18) |
| InChIKey | SIEBHFNYWHYTJW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|